Sign In | Join Free | My qualitytoyschina.com |
|
Place of Origin : WENZHOU
Brand Name : KCM&tailor-made
Certification : ISO9001: 2008, CE
MOQ : 10pc
Price : negotiation
Packaging Details : Usually packing by plywood case suit for sea delivery
Delivery Time : within few working days(depends on your quantity)
Payment Terms : L/C,T/T,FOB.CNF.CIF.PAYPAL,WESTUNTI
Supply Ability : flexible
1) Material: Brass, aluminum, stainless steel 316, stainless steel 304, nylon, polypropylene(PP)
2) Type: A, B, C, D, E, F, DC, and DP.
3) Size: 1/2", 3/4", 1", 1-1/4", 1-1/2", 1-3/4", 2", 2-1/2", 3", 4", 5" and 6"
Camlock Coupling, Hose Coupling, Cam And Groove Quick Coupling
Description:
Camlock coupling (cam and groove quick coupling)
Acoples rapidos kamlock (RACORES CAMLOCK, de levas, acoples rapidos a palanca)
Fabricados de acuerdo a la Especificacion MIL-C-27487 o DIN2828.
1) Material: Brass, aluminum, stainless steel 316, stainless steel 304, nylon, polypropylene(PP)
2) Type: A, B, C, D, E, F, DC, and DP.
3) Size: 1/2", 3/4", 1", 1-1/4", 1-1/2", 1-3/4", 2", 2-1/2", 3", 4", 5" and 6"
.
4) Feature:
(1) Precisely machined for accurate fit, join fast and save effort.
(2) Recess holds gasket firmly in place assuring proper placement.
(3) Smooth face of groove and great resistance to vibration.
5) We are the qualified member of NFPA.
Camlock Coupling TYPE A, B, C, D, E, F, DC, DP (Aluminum)
Material: Aluminum Alloy
Casting method: Gravity casting
Surface Finish: T6 Heat treatment
Handle: Brass & stainless steel
Sealing: NBR, EPDM, Viton, PTF
Safey Pin: Steel
Thread: ISO228(BSP)/ISO7(BSPT)/ANSI B1.20(NPT)
Size: 1/2", 3/4", 1", 1 1/4", 1 1/2", 2", 2 1/2", 3", 4", 5", 6"
6)Standard: A-A-59326(Repalced MIL-C-27487) or DIN2828
7)Technic:Die Casting, Gravity casting, precision Casting, Sand Casting, Forging, and Injection Moulding
Application:
Camlock coupling is used in a wide variety of applications for petroleum handling, chemical processing, dry bulk handling, agricultural, and water, etc.
Specification:
Aluminium |
|
PP |
|
|
|
Brass |
|
|||
Type |
|
SIZE |
|
Type |
|
SIZE |
|
Type |
|
SIZE |
A |
|
1/2" |
|
A |
|
1/2" |
|
A |
|
1/2" |
B |
|
3/4" |
|
B |
|
3/4" |
|
B |
|
3/4" |
C |
|
1" |
|
C |
|
1" |
|
C |
|
1" |
D |
|
1-1/4" |
|
D |
|
1-1/4" |
|
D |
|
1-1/4" |
E |
|
1-1/2" |
|
E |
|
1-1/2" |
|
E |
|
1-1/2" |
F |
|
2" |
|
F |
|
2" |
|
F |
|
2" |
DC |
|
2-1/2" |
|
DC |
|
2-1/2" |
|
DC |
|
2-1/2" |
DP |
|
3" |
|
DP |
|
3" |
|
DP |
|
3" |
|
|
4" |
|
|
|
4" |
|
|
|
4" |
|
|
5" |
|
|
|
|
|
|
|
5" |
|
|
6" |
|
|
|
|
|
|
|
6" |
|
|
8" |
|
|
|
|
|
|
|
|
Stainless Steel |
|
Nylon |
|
|
|
|
|
|||
Type |
|
SIZE |
|
Type |
|
SIZE |
|
|
|
|
A |
|
1/2" |
|
A |
|
1/2" |
|
|
|
|
B |
|
3/4" |
|
B |
|
3/4" |
|
|
|
|
C |
|
1" |
|
C |
|
1" |
|
|
|
|
D |
|
1-1/4" |
|
D |
|
1-1/4" |
|
|
|
|
E |
|
1-1/2" |
|
E |
|
1-1/2" |
|
|
|
|
F |
|
2" |
|
F |
|
2" |
|
|
|
|
DC |
|
2-1/2" |
|
DC |
|
2-1/2" |
|
|
|
|
DP |
|
3" |
|
DP |
|
3" |
|
|
|
|
|
|
4" |
|
|
|
4" |
|
|
|
|
|
|
5" |
|
|
|
|
|
|
|
|
|
|
6" |
|
|
|
|
|
|
|
|
Competitive Advantage:
1. Reasonable price with excellent quality
2. Abundant stock and prompt delivery
3. Rich supply and export experience, sincere service
4. Reliable forwarder, 1-hour away from port.
KCM TECHNOLOGY GROUP CO.,LTD
Address: Bin Hai Economic Development Industrial Zone.
WenZhou,ZheJiang Province,China
Tel :+0086-577-86879200
Fax :+86-577-86918728
Phone :+86 13175600492
Skype :Andy YOU 229
Web:www.kcmtech-valve.com&www.andy-valve.com
Email:admin@kcmtech-valve.com&sales@andy-valve.com
Main products:Cast steel(iron) gate check globe ball valve,strainer(API600)
Forged steel gate,globe,positionswing check valve(API602)
Forged steel ball valve,SS gate glove check ball valve(API603)
Stainless steel Camlock&grooved couplings,screwed fittings
![]() |
Stainless steel-Camlock coupling Type DC quick joint seres Images |